C11H10FNO — CID 122666941
7-fluoro-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole (PubChem CID 122666941) has the molecular formula C11H10FNO and a molecular weight of 191.21 g/mol. Its IUPAC name is 7-fluoro-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole.
| Compound Name | 7-fluoro-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole |
|---|---|
| PubChem CID | 122666941 |
| Molecular Formula | C11H10FNO |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 7-fluoro-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole |
| SMILES | Fc1ccc2cc3n(c2c1)CCOC3 |
| InChI | InChI=1S/C11H10FNO/c12-9-2-1-8-5-10-7-14-4-3-13(10)11(8)6-9/h1-2,5-6H,3-4,7H2 |
| InChIKey | IVAJRTKIWYMXDK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |