C12H12FNO — CID 122666947
7-fluoro-10-methyl-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole (PubChem CID 122666947) has the molecular formula C12H12FNO and a molecular weight of 205.23 g/mol. Its IUPAC name is 7-fluoro-10-methyl-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole.
| Compound Name | 7-fluoro-10-methyl-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole |
|---|---|
| PubChem CID | 122666947 |
| Molecular Formula | C12H12FNO |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 7-fluoro-10-methyl-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole |
| SMILES | Cc1c2n(c3cc(F)ccc13)CCOC2 |
| InChI | InChI=1S/C12H12FNO/c1-8-10-3-2-9(13)6-11(10)14-4-5-15-7-12(8)14/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | UTGSOAYUDVTNPQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|