C20H25N9S2 — CID 122667934
8-[[6-(azetidin-1-yl)-1,2,3-benzothiadiazol-5-yl]sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine (PubChem CID 122667934) has the molecular formula C20H25N9S2 and a molecular weight of 455.62 g/mol. Its IUPAC name is 8-[[6-(azetidin-1-yl)-1,2,3-benzothiadiazol-5-yl]sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine.
| Compound Name | 8-[[6-(azetidin-1-yl)-1,2,3-benzothiadiazol-5-yl]sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 122667934 |
| Molecular Formula | C20H25N9S2 |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 8-[[6-(azetidin-1-yl)-1,2,3-benzothiadiazol-5-yl]sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine |
| SMILES | CC(C)CNCCn1c(Sc2cc3nnsc3cc2N2CCC2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C20H25N9S2/c1-12(2)10-22-4-7-29-19-17(18(21)23-11-24-19)25-20(29)30-16-8-13-15(31-27-26-13)9-14(16)28-5-3-6-28/h8-9,11-12,22H,3-7,10H2,1-2H3,(H2,21,23,24) |
| InChIKey | KLHJELKZLVMRFQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|