C21H24N10OS — CID 122667959
9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[6-(1H-pyrazol-5-yl)-1,2,3-benzoxadiazol-5-yl]sulfanyl]purin-6-amine (PubChem CID 122667959) has the molecular formula C21H24N10OS and a molecular weight of 464.56 g/mol. Its IUPAC name is 9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[6-(1H-pyrazol-5-yl)-1,2,3-benzoxadiazol-5-yl]sulfanyl]purin-6-amine.
| Compound Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[6-(1H-pyrazol-5-yl)-1,2,3-benzoxadiazol-5-yl]sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 122667959 |
| Molecular Formula | C21H24N10OS |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[6-(1H-pyrazol-5-yl)-1,2,3-benzoxadiazol-5-yl]sulfanyl]purin-6-amine |
| SMILES | CC(C)(C)CNCCn1c(Sc2cc3nnoc3cc2-c2ccn[nH]2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C21H24N10OS/c1-21(2,3)10-23-6-7-31-19-17(18(22)24-11-25-19)27-20(31)33-16-9-14-15(32-30-29-14)8-12(16)13-4-5-26-28-13/h4-5,8-9,11,23H,6-7,10H2,1-3H3,(H,26,28)(H2,22,24,25) |
| InChIKey | HLNJGNRBRSXLBC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 149.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|