C28H41N5O3S — CID 122668144
N-[(1S)-3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-thieno[2,3-d][1,3]dioxol-2-ylpropyl]cyclohexanecarboxamide (PubChem CID 122668144) has the molecular formula C28H41N5O3S and a molecular weight of 527.74 g/mol. Its IUPAC name is N-[(1S)-3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-thieno[2,3-d][1,3]dioxol-2-ylpropyl]cyclohexanecarboxamide.
| Compound Name | N-[(1S)-3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-thieno[2,3-d][1,3]dioxol-2-ylpropyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 122668144 |
| Molecular Formula | C28H41N5O3S |
| Molecular Weight | 527.74 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | N-[(1S)-3-[3-(3-methyl-5-propan-2-yl-1,2,4-triazol-4-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-thieno[2,3-d][1,3]dioxol-2-ylpropyl]cyclohexanecarboxamide |
| SMILES | Cc1nnc(C(C)C)n1C1CC2CCC(C1)N2CC[C@H](NC(=O)C1CCCCC1)C1Oc2ccsc2O1 |
| InChI | InChI=1S/C28H41N5O3S/c1-17(2)25-31-30-18(3)33(25)22-15-20-9-10-21(16-22)32(20)13-11-23(27-35-24-12-14-37-28(24)36-27)29-26(34)19-7-5-4-6-8-19/h12,14,17,19-23,27H,4-11,13,15-16H2,1-3H3,(H,29,34)/t20?,21?,22?,23-,27?/m0/s1 |
| InChIKey | PEQPWQOYKXQQIC-QKNOUNDKSA-N |
| XLogP | 5.19 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.74 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |