About 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one
4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one (PubChem CID 122668398) has the molecular formula C13H15N3O2S
and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one.
Molecular Properties
| Compound Name | 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
| PubChem CID | 122668398 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one |
| SMILES | C=CCON1C(=O)N2CC(c3nccs3)=C(C)C1C2 |
| InChI | InChI=1S/C13H15N3O2S/c1-3-5-18-16-11-8-15(13(16)17)7-10(9(11)2)12-14-4-6-19-12/h3-4,6,11H,1,5,7-8H2,2H3 |
| InChIKey | GIALFBOTNMJNPF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one?
The IUPAC name of 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one (CID 122668398) is 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one.
What is the SMILES notation for 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one?
The canonical SMILES for 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one is C=CCON1C(=O)N2CC(c3nccs3)=C(C)C1C2.
What is the InChIKey of 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one?
The InChIKey is GIALFBOTNMJNPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2S/c1-3-5-18-16-11-8-15(13(16)17)7-10(9(11)2)12-14-4-6-19-12/h3-4,6,11H,1,5,7-8H2,2H3.
What are the key properties of 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one?
4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one has a molecular weight of 277.35 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-7-one is sourced from PubChem (CID 122668398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).