About (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate
(4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate (PubChem CID 122668649) has the molecular formula C9H6ClNO4
and a molecular weight of 227.60 g/mol. Its IUPAC name is (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate |
| PubChem CID | 122668649 |
| Molecular Formula | C9H6ClNO4 |
| Molecular Weight | 227.60 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate |
| SMILES | O=C1Cc2c(ccc(OC(=O)O)c2Cl)N1 |
| InChI | InChI=1S/C9H6ClNO4/c10-8-4-3-7(12)11-5(4)1-2-6(8)15-9(13)14/h1-2H,3H2,(H,11,12)(H,13,14) |
| InChIKey | OTXYFMYTZIGPPG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.60 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate?
The IUPAC name of (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate (CID 122668649) is (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate.
What is the SMILES notation for (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate?
The canonical SMILES for (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate is O=C1Cc2c(ccc(OC(=O)O)c2Cl)N1.
What is the InChIKey of (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate?
The InChIKey is OTXYFMYTZIGPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO4/c10-8-4-3-7(12)11-5(4)1-2-6(8)15-9(13)14/h1-2H,3H2,(H,11,12)(H,13,14).
What are the key properties of (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate?
(4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate has a molecular weight of 227.60 g/mol, XLogP of 1.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2-oxo-1,3-dihydroindol-5-yl) hydrogen carbonate is sourced from PubChem (CID 122668649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).