C21H25ClO8S — CID 122669032
(2R,3R,8R)-8-[(8-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)sulfonyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylic acid (PubChem CID 122669032) has the molecular formula C21H25ClO8S and a molecular weight of 472.94 g/mol. Its IUPAC name is (2R,3R,8R)-8-[(8-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)sulfonyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylic acid.
| Compound Name | (2R,3R,8R)-8-[(8-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)sulfonyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylic acid |
|---|---|
| PubChem CID | 122669032 |
| Molecular Formula | C21H25ClO8S |
| Molecular Weight | 472.94 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (2R,3R,8R)-8-[(8-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)sulfonyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylic acid |
| SMILES | O=C(O)C1=CC2(CC[C@H]1S(=O)(=O)C1CCCc3cccc(Cl)c31)O[C@H](CO)[C@@H](CO)O2 |
| InChI | InChI=1S/C21H25ClO8S/c22-14-5-1-3-12-4-2-6-18(19(12)14)31(27,28)17-7-8-21(9-13(17)20(25)26)29-15(10-23)16(11-24)30-21/h1,3,5,9,15-18,23-24H,2,4,6-8,10-11H2,(H,25,26)/t15-,16-,17-,18?/m1/s1 |
| InChIKey | FEQIGHXXZNQVCF-NGHJQRJNSA-N |
| XLogP | 1.77 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.94 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |