C28H25F8N3O3S — CID 122669112
4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carbonitrile (PubChem CID 122669112) has the molecular formula C28H25F8N3O3S and a molecular weight of 635.58 g/mol. Its IUPAC name is 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carbonitrile.
| Compound Name | 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carbonitrile |
|---|---|
| PubChem CID | 122669112 |
| Molecular Formula | C28H25F8N3O3S |
| Molecular Weight | 635.58 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carbonitrile |
| SMILES | N#CN1CCC(C(=O)N2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C28H25F8N3O3S/c29-20-3-5-21(6-4-20)43(41,42)25-11-14-39(24(40)17-9-12-38(16-37)13-10-17)23(25)8-1-18-15-19(2-7-22(18)25)26(30,27(31,32)33)28(34,35)36/h2-7,15,17,23H,1,8-14H2/t23-,25-/m1/s1 |
| InChIKey | YQTJHRVUUFXQJE-ILBGXUMGSA-N |
| XLogP | 5.52 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|