C22H26FNO2S — CID 122669145
7-tert-butyl-9b-(3-fluorophenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indole (PubChem CID 122669145) has the molecular formula C22H26FNO2S and a molecular weight of 387.52 g/mol. Its IUPAC name is 7-tert-butyl-9b-(3-fluorophenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indole.
| Compound Name | 7-tert-butyl-9b-(3-fluorophenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 122669145 |
| Molecular Formula | C22H26FNO2S |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 7-tert-butyl-9b-(3-fluorophenyl)sulfonyl-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
| SMILES | CC(C)(C)c1ccc2c(c1)CCC1NCCC21S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C22H26FNO2S/c1-21(2,3)16-8-9-19-15(13-16)7-10-20-22(19,11-12-24-20)27(25,26)18-6-4-5-17(23)14-18/h4-6,8-9,13-14,20,24H,7,10-12H2,1-3H3 |
| InChIKey | TTYIYMBIDMPFIK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |