C29H26ClF8NO5S — CID 122669221
4-[(3aR,9bR)-8-chloro-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 122669221) has the molecular formula C29H26ClF8NO5S and a molecular weight of 688.03 g/mol. Its IUPAC name is 4-[(3aR,9bR)-8-chloro-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3aR,9bR)-8-chloro-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122669221 |
| Molecular Formula | C29H26ClF8NO5S |
| Molecular Weight | 688.03 g/mol |
| Exact Mass | 687.11 |
| IUPAC Name | 4-[(3aR,9bR)-8-chloro-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4cc(Cl)c(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C29H26ClF8NO5S/c30-22-14-20-17(13-21(22)27(32,28(33,34)35)29(36,37)38)5-10-23-26(20,45(43,44)19-8-6-18(31)7-9-19)11-12-39(23)24(40)15-1-3-16(4-2-15)25(41)42/h6-9,13-16,23H,1-5,10-12H2,(H,41,42)/t15?,16?,23-,26-/m1/s1 |
| InChIKey | NRSGHJVWWWPCST-KJTSFZHVSA-N |
| XLogP | 6.88 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.03 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |