C30H30F8N2O4S — CID 122669251
4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-methylcyclohexane-1-carboxamide (PubChem CID 122669251) has the molecular formula C30H30F8N2O4S and a molecular weight of 666.63 g/mol. Its IUPAC name is 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-methylcyclohexane-1-carboxamide.
| Compound Name | 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 122669251 |
| Molecular Formula | C30H30F8N2O4S |
| Molecular Weight | 666.63 g/mol |
| Exact Mass | 666.18 |
| IUPAC Name | 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-methylcyclohexane-1-carboxamide |
| SMILES | CC1(C(=O)N2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C30H30F8N2O4S/c1-26(12-10-17(11-13-26)24(39)41)25(42)40-15-14-27(45(43,44)21-6-4-20(31)5-7-21)22-8-3-19(16-18(22)2-9-23(27)40)28(32,29(33,34)35)30(36,37)38/h3-8,16-17,23H,2,9-15H2,1H3,(H2,39,41)/t17?,23-,26?,27-/m1/s1 |
| InChIKey | ONFZNJMYTDFRQY-XJQUJQRNSA-N |
| XLogP | 6.01 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |