C23H22F7NO5S — CID 122669332
[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methylcyclohexyl]carbamic acid (PubChem CID 122669332) has the molecular formula C23H22F7NO5S and a molecular weight of 557.48 g/mol. Its IUPAC name is [4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methylcyclohexyl]carbamic acid.
| Compound Name | [4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methylcyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 122669332 |
| Molecular Formula | C23H22F7NO5S |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | [4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methylcyclohexyl]carbamic acid |
| SMILES | CC1(NC(=O)O)CCC(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H22F7NO5S/c1-19(31-18(32)33)10-12-20(13-11-19,37(35,36)17-8-6-16(24)7-9-17)14-2-4-15(5-3-14)21(34,22(25,26)27)23(28,29)30/h2-9,31,34H,10-13H2,1H3,(H,32,33) |
| InChIKey | SUDXHHYTWPKKKA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |