About 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid
1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid (PubChem CID 122669544) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid.
Molecular Properties
| Compound Name | 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid |
| PubChem CID | 122669544 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid |
| SMILES | CC(CN1C[C@@H]2CC[C@@H](C2)C1)NC(=O)O |
| InChI | InChI=1S/C11H20N2O2/c1-8(12-11(14)15)5-13-6-9-2-3-10(4-9)7-13/h8-10,12H,2-7H2,1H3,(H,14,15)/t8?,9-,10+ |
| InChIKey | PBDBJTKGUFQJEZ-PBINXNQUSA-N |
| XLogP | 1.37 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid?
The IUPAC name of 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid (CID 122669544) is 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid.
What is the SMILES notation for 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid?
The canonical SMILES for 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid is CC(CN1C[C@@H]2CC[C@@H](C2)C1)NC(=O)O.
What is the InChIKey of 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid?
The InChIKey is PBDBJTKGUFQJEZ-PBINXNQUSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-8(12-11(14)15)5-13-6-9-2-3-10(4-9)7-13/h8-10,12H,2-7H2,1H3,(H,14,15)/t8?,9-,10+.
What are the key properties of 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid?
1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid has a molecular weight of 212.29 g/mol, XLogP of 1.37, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,5S)-3-azabicyclo[3.2.1]octan-3-yl]propan-2-ylcarbamic acid is sourced from PubChem (CID 122669544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).