About 4-(3-chloropropoxy)-2,6-difluoropyridine
4-(3-chloropropoxy)-2,6-difluoropyridine (PubChem CID 122669776) has the molecular formula C8H8ClF2NO
and a molecular weight of 207.61 g/mol. Its IUPAC name is 4-(3-chloropropoxy)-2,6-difluoropyridine.
Molecular Properties
| Compound Name | 4-(3-chloropropoxy)-2,6-difluoropyridine |
| PubChem CID | 122669776 |
| Molecular Formula | C8H8ClF2NO |
| Molecular Weight | 207.61 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 4-(3-chloropropoxy)-2,6-difluoropyridine |
| SMILES | Fc1cc(OCCCCl)cc(F)n1 |
| InChI | InChI=1S/C8H8ClF2NO/c9-2-1-3-13-6-4-7(10)12-8(11)5-6/h4-5H,1-3H2 |
| InChIKey | GWIRUBMIQLBKLW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloropropoxy)-2,6-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloropropoxy)-2,6-difluoropyridine?
The IUPAC name of 4-(3-chloropropoxy)-2,6-difluoropyridine (CID 122669776) is 4-(3-chloropropoxy)-2,6-difluoropyridine.
What is the SMILES notation for 4-(3-chloropropoxy)-2,6-difluoropyridine?
The canonical SMILES for 4-(3-chloropropoxy)-2,6-difluoropyridine is Fc1cc(OCCCCl)cc(F)n1.
What is the InChIKey of 4-(3-chloropropoxy)-2,6-difluoropyridine?
The InChIKey is GWIRUBMIQLBKLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClF2NO/c9-2-1-3-13-6-4-7(10)12-8(11)5-6/h4-5H,1-3H2.
What are the key properties of 4-(3-chloropropoxy)-2,6-difluoropyridine?
4-(3-chloropropoxy)-2,6-difluoropyridine has a molecular weight of 207.61 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloropropoxy)-2,6-difluoropyridine is sourced from PubChem (CID 122669776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).