C26H28N4O4S — CID 122670156
cis-(1S,4R)-4-hydroxy-2,2-dimethyl-4-[5-[3-methyl-5-[(4-methylfuro[3,2-d]pyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid (PubChem CID 122670156) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is cis-(1S,4R)-4-hydroxy-2,2-dimethyl-4-[5-[3-methyl-5-[(4-methylfuro[3,2-d]pyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,4R)-4-hydroxy-2,2-dimethyl-4-[5-[3-methyl-5-[(4-methylfuro[3,2-d]pyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122670156 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | cis-(1S,4R)-4-hydroxy-2,2-dimethyl-4-[5-[3-methyl-5-[(4-methylfuro[3,2-d]pyrimidin-2-yl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(Nc2nc(C)c3occc3n2)cc(-c2cnc([C@@]3(O)CC[C@H](C(=O)O)C(C)(C)C3)s2)c1 |
| InChI | InChI=1S/C26H28N4O4S/c1-14-9-16(11-17(10-14)29-24-28-15(2)21-19(30-24)6-8-34-21)20-12-27-23(35-20)26(33)7-5-18(22(31)32)25(3,4)13-26/h6,8-12,18,33H,5,7,13H2,1-4H3,(H,31,32)(H,28,29,30)/t18-,26-/m1/s1 |
| InChIKey | NLJOPMIQVPXQNY-WXTAPIANSA-N |
| XLogP | 5.81 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |