About 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate
1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate (PubChem CID 122671281) has the molecular formula C22H25NO10
and a molecular weight of 463.44 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate |
| PubChem CID | 122671281 |
| Molecular Formula | C22H25NO10 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate |
| SMILES | CC(=O)OC(CC(=O)O[C@H](C(=O)ON1C(=O)CCC1=O)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H25NO10/c1-13(24)30-15(20(28)32-22(2,3)4)12-18(27)31-19(14-8-6-5-7-9-14)21(29)33-23-16(25)10-11-17(23)26/h5-9,15,19H,10-12H2,1-4H3/t15?,19-/m0/s1 |
| InChIKey | FUYLJKSOKCTKPV-FUBQLUNQSA-N |
| XLogP | 1.54 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate?
The IUPAC name of 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate (CID 122671281) is 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate.
What is the SMILES notation for 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate?
The canonical SMILES for 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate is CC(=O)OC(CC(=O)O[C@H](C(=O)ON1C(=O)CCC1=O)c1ccccc1)C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate?
The InChIKey is FUYLJKSOKCTKPV-FUBQLUNQSA-N. The full InChI is InChI=1S/C22H25NO10/c1-13(24)30-15(20(28)32-22(2,3)4)12-18(27)31-19(14-8-6-5-7-9-14)21(29)33-23-16(25)10-11-17(23)26/h5-9,15,19H,10-12H2,1-4H3/t15?,19-/m0/s1.
What are the key properties of 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate?
1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate has a molecular weight of 463.44 g/mol, XLogP of 1.54, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 4-O-[(1S)-2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxo-1-phenylethyl] 2-acetyloxybutanedioate is sourced from PubChem (CID 122671281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).