About 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one
2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one (PubChem CID 122672553) has the molecular formula C15H17F2NO2
and a molecular weight of 281.30 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one |
| PubChem CID | 122672553 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one |
| SMILES | O=C1N(c2cc(F)cc(F)c2)CCC12CCC(O)CC2 |
| InChI | InChI=1S/C15H17F2NO2/c16-10-7-11(17)9-12(8-10)18-6-5-15(14(18)20)3-1-13(19)2-4-15/h7-9,13,19H,1-6H2 |
| InChIKey | SSCPAOFPAYGHMP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one?
The IUPAC name of 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one (CID 122672553) is 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one.
What is the SMILES notation for 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one?
The canonical SMILES for 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one is O=C1N(c2cc(F)cc(F)c2)CCC12CCC(O)CC2.
What is the InChIKey of 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one?
The InChIKey is SSCPAOFPAYGHMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2NO2/c16-10-7-11(17)9-12(8-10)18-6-5-15(14(18)20)3-1-13(19)2-4-15/h7-9,13,19H,1-6H2.
What are the key properties of 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one?
2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one has a molecular weight of 281.30 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-8-hydroxy-2-azaspiro[4.5]decan-1-one is sourced from PubChem (CID 122672553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).