About 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate
2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate (PubChem CID 122673079) has the molecular formula C13H17NO5
and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate.
Molecular Properties
| Compound Name | 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate |
| PubChem CID | 122673079 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate |
| SMILES | C=CC(=O)OOCCC1CCCCC12C(=O)NC2=O |
| InChI | InChI=1S/C13H17NO5/c1-2-10(15)19-18-8-6-9-5-3-4-7-13(9)11(16)14-12(13)17/h2,9H,1,3-8H2,(H,14,16,17) |
| InChIKey | YLRBVUANCWXXRA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate?
The IUPAC name of 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate (CID 122673079) is 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate.
What is the SMILES notation for 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate?
The canonical SMILES for 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate is C=CC(=O)OOCCC1CCCCC12C(=O)NC2=O.
What is the InChIKey of 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate?
The InChIKey is YLRBVUANCWXXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5/c1-2-10(15)19-18-8-6-9-5-3-4-7-13(9)11(16)14-12(13)17/h2,9H,1,3-8H2,(H,14,16,17).
What are the key properties of 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate?
2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate has a molecular weight of 267.28 g/mol, XLogP of 0.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxo-2-azaspiro[3.5]nonan-5-yl)ethyl prop-2-eneperoxoate is sourced from PubChem (CID 122673079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).