About 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride
3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride (PubChem CID 122673361) has the molecular formula C7H11ClN4O
and a molecular weight of 202.65 g/mol. Its IUPAC name is 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride |
| PubChem CID | 122673361 |
| Molecular Formula | C7H11ClN4O |
| Molecular Weight | 202.65 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride |
| SMILES | Cc1nn2c(c1N)C(=O)NCC2.Cl |
| InChI | InChI=1S/C7H10N4O.ClH/c1-4-5(8)6-7(12)9-2-3-11(6)10-4;/h2-3,8H2,1H3,(H,9,12);1H |
| InChIKey | MTQKOGSJHJLJPJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.65 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride?
The IUPAC name of 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride (CID 122673361) is 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride.
What is the SMILES notation for 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride?
The canonical SMILES for 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride is Cc1nn2c(c1N)C(=O)NCC2.Cl.
What is the InChIKey of 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride?
The InChIKey is MTQKOGSJHJLJPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O.ClH/c1-4-5(8)6-7(12)9-2-3-11(6)10-4;/h2-3,8H2,1H3,(H,9,12);1H.
What are the key properties of 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride?
3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride has a molecular weight of 202.65 g/mol, XLogP of -0.06, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-methyl-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one;hydrochloride is sourced from PubChem (CID 122673361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).