C20H20N2O2S2 — CID 122673514
5-(5-ethoxythiophen-3-yl)sulfanyl-3-(furan-2-yl)-2-(1,2,3,6-tetrahydropyridin-6-yl)pyridine (PubChem CID 122673514) has the molecular formula C20H20N2O2S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 5-(5-ethoxythiophen-3-yl)sulfanyl-3-(furan-2-yl)-2-(1,2,3,6-tetrahydropyridin-6-yl)pyridine.
| Compound Name | 5-(5-ethoxythiophen-3-yl)sulfanyl-3-(furan-2-yl)-2-(1,2,3,6-tetrahydropyridin-6-yl)pyridine |
|---|---|
| PubChem CID | 122673514 |
| Molecular Formula | C20H20N2O2S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 5-(5-ethoxythiophen-3-yl)sulfanyl-3-(furan-2-yl)-2-(1,2,3,6-tetrahydropyridin-6-yl)pyridine |
| SMILES | CCOc1cc(Sc2cnc(C3C=CCCN3)c(-c3ccco3)c2)cs1 |
| InChI | InChI=1S/C20H20N2O2S2/c1-2-23-19-11-15(13-25-19)26-14-10-16(18-7-5-9-24-18)20(22-12-14)17-6-3-4-8-21-17/h3,5-7,9-13,17,21H,2,4,8H2,1H3 |
| InChIKey | IWFMHHDUFBRHFU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|