About (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate
(1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate (PubChem CID 122673531) has the molecular formula C13H12F3NO4S
and a molecular weight of 335.30 g/mol. Its IUPAC name is (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate |
| PubChem CID | 122673531 |
| Molecular Formula | C13H12F3NO4S |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate |
| SMILES | O=C1C=C(OS(=O)(=O)C(F)(F)F)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C13H12F3NO4S/c14-13(15,16)22(19,20)21-12-6-11(18)8-17(9-12)7-10-4-2-1-3-5-10/h1-6H,7-9H2 |
| InChIKey | YDVVUNFRVPSJND-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate?
The IUPAC name of (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate (CID 122673531) is (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate.
What is the SMILES notation for (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate?
The canonical SMILES for (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate is O=C1C=C(OS(=O)(=O)C(F)(F)F)CN(Cc2ccccc2)C1.
What is the InChIKey of (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate?
The InChIKey is YDVVUNFRVPSJND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3NO4S/c14-13(15,16)22(19,20)21-12-6-11(18)8-17(9-12)7-10-4-2-1-3-5-10/h1-6H,7-9H2.
What are the key properties of (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate?
(1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate has a molecular weight of 335.30 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzyl-5-oxo-2,6-dihydropyridin-3-yl) trifluoromethanesulfonate is sourced from PubChem (CID 122673531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).