C18H24N6O2 — CID 122673720
N-ethyl-2-[[(2S,4S)-2-methyl-1-prop-2-enoylpiperidin-4-yl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 122673720) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-ethyl-2-[[(2S,4S)-2-methyl-1-prop-2-enoylpiperidin-4-yl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-ethyl-2-[[(2S,4S)-2-methyl-1-prop-2-enoylpiperidin-4-yl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 122673720 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-ethyl-2-[[(2S,4S)-2-methyl-1-prop-2-enoylpiperidin-4-yl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C=CC(=O)N1CC[C@H](Nc2cnc3[nH]cc(C(=O)NCC)c3n2)C[C@@H]1C |
| InChI | InChI=1S/C18H24N6O2/c1-4-15(25)24-7-6-12(8-11(24)3)22-14-10-21-17-16(23-14)13(9-20-17)18(26)19-5-2/h4,9-12H,1,5-8H2,2-3H3,(H,19,26)(H,20,21)(H,22,23)/t11-,12-/m0/s1 |
| InChIKey | OOPLWRZCJCWOAZ-RYUDHWBXSA-N |
| XLogP | 1.68 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|