C16H34O2 — CID 122674638
6-tert-butyl-2-ethyl-2-methylnonane-1,1-diol (PubChem CID 122674638) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is 6-tert-butyl-2-ethyl-2-methylnonane-1,1-diol.
| Compound Name | 6-tert-butyl-2-ethyl-2-methylnonane-1,1-diol |
|---|---|
| PubChem CID | 122674638 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 6-tert-butyl-2-ethyl-2-methylnonane-1,1-diol |
| SMILES | CCCC(CCCC(C)(CC)C(O)O)C(C)(C)C |
| InChI | InChI=1S/C16H34O2/c1-7-10-13(15(3,4)5)11-9-12-16(6,8-2)14(17)18/h13-14,17-18H,7-12H2,1-6H3 |
| InChIKey | QRDPOHYEVXWIDU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|