C14H24F2N2O4 — CID 122675690
tert-butyl N-[(2R)-1-[3-(difluoromethoxy)piperidin-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 122675690) has the molecular formula C14H24F2N2O4 and a molecular weight of 322.35 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[3-(difluoromethoxy)piperidin-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[3-(difluoromethoxy)piperidin-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 122675690 |
| Molecular Formula | C14H24F2N2O4 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | tert-butyl N-[(2R)-1-[3-(difluoromethoxy)piperidin-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)N1CCCC(OC(F)F)C1 |
| InChI | InChI=1S/C14H24F2N2O4/c1-9(17-13(20)22-14(2,3)4)11(19)18-7-5-6-10(8-18)21-12(15)16/h9-10,12H,5-8H2,1-4H3,(H,17,20)/t9-,10?/m1/s1 |
| InChIKey | UQRWRGFXXHNLPQ-YHMJZVADSA-N |
| XLogP | 2.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |