C27H42O7 — CID 122675807
[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-7-carboxyoxy-12-formyloxy-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate (PubChem CID 122675807) has the molecular formula C27H42O7 and a molecular weight of 478.63 g/mol. Its IUPAC name is [(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-7-carboxyoxy-12-formyloxy-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate.
| Compound Name | [(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-7-carboxyoxy-12-formyloxy-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
|---|---|
| PubChem CID | 122675807 |
| Molecular Formula | C27H42O7 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | [(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-7-carboxyoxy-12-formyloxy-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
| SMILES | CCCC(C)[C@H]1CC[C@H]2[C@@H]3[C@H](OC(=O)O)C[C@@H]4C[C@H](OC=O)CC[C@]4(C)[C@H]3C[C@H](OC=O)[C@]12C |
| InChI | InChI=1S/C27H42O7/c1-5-6-16(2)19-7-8-20-24-21(13-23(33-15-29)27(19,20)4)26(3)10-9-18(32-14-28)11-17(26)12-22(24)34-25(30)31/h14-24H,5-13H2,1-4H3,(H,30,31)/t16?,17-,18+,19+,20-,21-,22+,23-,24-,26-,27+/m0/s1 |
| InChIKey | OVHRNLFTRMMVPF-GQUVMGCESA-N |
| XLogP | 5.45 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|