C22H22F5N — CID 122675900
(3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole (PubChem CID 122675900) has the molecular formula C22H22F5N and a molecular weight of 395.42 g/mol. Its IUPAC name is (3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole.
| Compound Name | (3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 122675900 |
| Molecular Formula | C22H22F5N |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (3aR,9bS)-9b-[(4-fluorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
| SMILES | CC(F)(c1ccc2c(c1)CC[C@H]1NCC[C@@]21Cc1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H22F5N/c1-20(24,22(25,26)27)16-5-8-18-15(12-16)4-9-19-21(18,10-11-28-19)13-14-2-6-17(23)7-3-14/h2-3,5-8,12,19,28H,4,9-11,13H2,1H3/t19-,20?,21-/m1/s1 |
| InChIKey | XPCBOKMFFMWPMA-GIBKCMNESA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |