C22H22ClF4N — CID 122675916
9b-[(3-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole (PubChem CID 122675916) has the molecular formula C22H22ClF4N and a molecular weight of 411.87 g/mol. Its IUPAC name is 9b-[(3-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole.
| Compound Name | 9b-[(3-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 122675916 |
| Molecular Formula | C22H22ClF4N |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 9b-[(3-chlorophenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
| SMILES | CC(F)(c1ccc2c(c1)CCC1NCCC21Cc1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C22H22ClF4N/c1-20(24,22(25,26)27)16-6-7-18-15(12-16)5-8-19-21(18,9-10-28-19)13-14-3-2-4-17(23)11-14/h2-4,6-7,11-12,19,28H,5,8-10,13H2,1H3 |
| InChIKey | QULSUUJXBHKCHQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |