C23H24F5N — CID 122675922
9b-[(4-fluoro-3-methylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole (PubChem CID 122675922) has the molecular formula C23H24F5N and a molecular weight of 409.44 g/mol. Its IUPAC name is 9b-[(4-fluoro-3-methylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole.
| Compound Name | 9b-[(4-fluoro-3-methylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 122675922 |
| Molecular Formula | C23H24F5N |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 9b-[(4-fluoro-3-methylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
| SMILES | Cc1cc(CC23CCNC2CCc2cc(C(C)(F)C(F)(F)F)ccc23)ccc1F |
| InChI | InChI=1S/C23H24F5N/c1-14-11-15(3-7-19(14)24)13-22-9-10-29-20(22)8-4-16-12-17(5-6-18(16)22)21(2,25)23(26,27)28/h3,5-7,11-12,20,29H,4,8-10,13H2,1-2H3 |
| InChIKey | PJLCYMICMKLHEV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |