About cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate
cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate (PubChem CID 122676725) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate |
| PubChem CID | 122676725 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate |
| SMILES | C[C@H]1CC(=O)CC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20O3/c1-8-7-9(13)5-6-10(8)11(14)15-12(2,3)4/h8,10H,5-7H2,1-4H3/t8-,10+/m0/s1 |
| InChIKey | GOSCCVTXSPXIEI-WCBMZHEXSA-N |
| XLogP | 2.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate?
The IUPAC name of cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate (CID 122676725) is cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate.
What is the SMILES notation for cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate?
The canonical SMILES for cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate is C[C@H]1CC(=O)CC[C@H]1C(=O)OC(C)(C)C.
What is the InChIKey of cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate?
The InChIKey is GOSCCVTXSPXIEI-WCBMZHEXSA-N. The full InChI is InChI=1S/C12H20O3/c1-8-7-9(13)5-6-10(8)11(14)15-12(2,3)4/h8,10H,5-7H2,1-4H3/t8-,10+/m0/s1.
What are the key properties of cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate?
cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate has a molecular weight of 212.29 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-tert-butyl (1R,2S)-2-methyl-4-oxocyclohexane-1-carboxylate is sourced from PubChem (CID 122676725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).