C13H29O6P — CID 122676916
2-methoxy-2-(4-methoxybutoxy)-2-propoxy-1,3,2λ5-dioxaphosphepane (PubChem CID 122676916) has the molecular formula C13H29O6P and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-methoxy-2-(4-methoxybutoxy)-2-propoxy-1,3,2λ5-dioxaphosphepane.
| Compound Name | 2-methoxy-2-(4-methoxybutoxy)-2-propoxy-1,3,2λ5-dioxaphosphepane |
|---|---|
| PubChem CID | 122676916 |
| Molecular Formula | C13H29O6P |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-methoxy-2-(4-methoxybutoxy)-2-propoxy-1,3,2λ5-dioxaphosphepane |
| SMILES | CCCOP1(OC)(OCCCCOC)OCCCCO1 |
| InChI | InChI=1S/C13H29O6P/c1-4-9-16-20(15-3,17-11-6-5-10-14-2)18-12-7-8-13-19-20/h4-13H2,1-3H3 |
| InChIKey | YRAAWYNHSCZMHL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|