C30H24F7NO5S — CID 122677022
methyl 4-cyano-3-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate (PubChem CID 122677022) has the molecular formula C30H24F7NO5S and a molecular weight of 643.58 g/mol. Its IUPAC name is methyl 4-cyano-3-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate.
| Compound Name | methyl 4-cyano-3-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 122677022 |
| Molecular Formula | C30H24F7NO5S |
| Molecular Weight | 643.58 g/mol |
| Exact Mass | 643.13 |
| IUPAC Name | methyl 4-cyano-3-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(C#N)c(COC(c2ccc(C3(S(=O)(=O)c4ccc(F)cc4)CCCC3)cc2)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C30H24F7NO5S/c1-42-26(39)19-4-5-20(17-38)21(16-19)18-43-28(29(32,33)34,30(35,36)37)23-8-6-22(7-9-23)27(14-2-3-15-27)44(40,41)25-12-10-24(31)11-13-25/h4-13,16H,2-3,14-15,18H2,1H3 |
| InChIKey | FSACVZCIKYAXKO-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.58 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |