About (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol
(1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol (PubChem CID 122678083) has the molecular formula C15H20F2OS
and a molecular weight of 286.39 g/mol. Its IUPAC name is (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol.
Molecular Properties
| Compound Name | (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol |
| PubChem CID | 122678083 |
| Molecular Formula | C15H20F2OS |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol |
| SMILES | C=CCCC[C@H](O)c1ccc(SC(F)(F)CC)cc1 |
| InChI | InChI=1S/C15H20F2OS/c1-3-5-6-7-14(18)12-8-10-13(11-9-12)19-15(16,17)4-2/h3,8-11,14,18H,1,4-7H2,2H3/t14-/m0/s1 |
| InChIKey | LRNJZPKJTSCYQO-AWEZNQCLSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol?
The IUPAC name of (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol (CID 122678083) is (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol.
What is the SMILES notation for (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol?
The canonical SMILES for (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol is C=CCCC[C@H](O)c1ccc(SC(F)(F)CC)cc1.
What is the InChIKey of (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol?
The InChIKey is LRNJZPKJTSCYQO-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H20F2OS/c1-3-5-6-7-14(18)12-8-10-13(11-9-12)19-15(16,17)4-2/h3,8-11,14,18H,1,4-7H2,2H3/t14-/m0/s1.
What are the key properties of (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol?
(1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol has a molecular weight of 286.39 g/mol, XLogP of 5.17, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[4-(1,1-difluoropropylsulfanyl)phenyl]hex-5-en-1-ol is sourced from PubChem (CID 122678083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).