C33H27F2N5O — CID 122678497
10-(2-fluorocyclohexa-1,5-dien-1-yl)-20-(2-fluorophenyl)-2,3,12,13,22,24-hexahydroporphyrin-5-carboxamide (PubChem CID 122678497) has the molecular formula C33H27F2N5O and a molecular weight of 547.61 g/mol. Its IUPAC name is 10-(2-fluorocyclohexa-1,5-dien-1-yl)-20-(2-fluorophenyl)-2,3,12,13,22,24-hexahydroporphyrin-5-carboxamide.
| Compound Name | 10-(2-fluorocyclohexa-1,5-dien-1-yl)-20-(2-fluorophenyl)-2,3,12,13,22,24-hexahydroporphyrin-5-carboxamide |
|---|---|
| PubChem CID | 122678497 |
| Molecular Formula | C33H27F2N5O |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 10-(2-fluorocyclohexa-1,5-dien-1-yl)-20-(2-fluorophenyl)-2,3,12,13,22,24-hexahydroporphyrin-5-carboxamide |
| SMILES | NC(=O)c1c2nc(c(-c3ccccc3F)c3ccc(cc4nc(c(C5=C(F)CCC=C5)c5ccc1[nH]5)CC4)[nH]3)CC2 |
| InChI | InChI=1S/C33H27F2N5O/c34-22-7-3-1-5-20(22)30-24-11-9-18(37-24)17-19-10-12-25(38-19)31(21-6-2-4-8-23(21)35)27-14-16-29(40-27)32(33(36)41)28-15-13-26(30)39-28/h1-3,5-7,9,11,14,16-17,37,40H,4,8,10,12-13,15H2,(H2,36,41)/b18-17-,19-17-,30-24-,30-26-,31-25-,31-27-,32-28+,32-29+ |
| InChIKey | ITUPGHXAVYWEJL-JADVJRHPSA-N |
| XLogP | 6.82 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |