C28H22F8N2O4S — CID 122678500
5-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-1-methylpyridin-2-one (PubChem CID 122678500) has the molecular formula C28H22F8N2O4S and a molecular weight of 634.55 g/mol. Its IUPAC name is 5-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-1-methylpyridin-2-one.
| Compound Name | 5-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 122678500 |
| Molecular Formula | C28H22F8N2O4S |
| Molecular Weight | 634.55 g/mol |
| Exact Mass | 634.12 |
| IUPAC Name | 5-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(C(=O)N2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)ccc1=O |
| InChI | InChI=1S/C28H22F8N2O4S/c1-37-15-17(3-11-23(37)39)24(40)38-13-12-25(43(41,42)20-7-5-19(29)6-8-20)21-9-4-18(14-16(21)2-10-22(25)38)26(30,27(31,32)33)28(34,35)36/h3-9,11,14-15,22H,2,10,12-13H2,1H3/t22-,25-/m1/s1 |
| InChIKey | OVTLIBRJQHFICL-RCZVLFRGSA-N |
| XLogP | 5.34 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |