C15H23F3N2O2 — CID 122678509
(3Z)-4-(hydroxymethyl)-3-prop-2-enylidene-1-(6,6,6-trifluoro-5-methylhexyl)piperazin-2-one (PubChem CID 122678509) has the molecular formula C15H23F3N2O2 and a molecular weight of 320.36 g/mol. Its IUPAC name is (3Z)-4-(hydroxymethyl)-3-prop-2-enylidene-1-(6,6,6-trifluoro-5-methylhexyl)piperazin-2-one.
| Compound Name | (3Z)-4-(hydroxymethyl)-3-prop-2-enylidene-1-(6,6,6-trifluoro-5-methylhexyl)piperazin-2-one |
|---|---|
| PubChem CID | 122678509 |
| Molecular Formula | C15H23F3N2O2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (3Z)-4-(hydroxymethyl)-3-prop-2-enylidene-1-(6,6,6-trifluoro-5-methylhexyl)piperazin-2-one |
| SMILES | C=C/C=C1/C(=O)N(CCCCC(C)C(F)(F)F)CCN1CO |
| InChI | InChI=1S/C15H23F3N2O2/c1-3-6-13-14(22)19(9-10-20(13)11-21)8-5-4-7-12(2)15(16,17)18/h3,6,12,21H,1,4-5,7-11H2,2H3/b13-6- |
| InChIKey | MMPPNNPTACRACY-MLPAPPSSSA-N |
| XLogP | 2.52 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|