C28H27F8NO5S2 — CID 122678514
[(1R)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone (PubChem CID 122678514) has the molecular formula C28H27F8NO5S2 and a molecular weight of 673.64 g/mol. Its IUPAC name is [(1R)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone.
| Compound Name | [(1R)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone |
|---|---|
| PubChem CID | 122678514 |
| Molecular Formula | C28H27F8NO5S2 |
| Molecular Weight | 673.64 g/mol |
| Exact Mass | 673.12 |
| IUPAC Name | [(1R)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone |
| SMILES | C[C@@H]1CN(C(=O)C2CCS(=O)(=O)CC2)C2CCc3cc(C(F)(C(F)(F)F)C(F)(F)F)ccc3C21S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H27F8NO5S2/c1-16-15-37(24(38)17-10-12-43(39,40)13-11-17)23-9-2-18-14-19(26(30,27(31,32)33)28(34,35)36)3-8-22(18)25(16,23)44(41,42)21-6-4-20(29)5-7-21/h3-8,14,16-17,23H,2,9-13,15H2,1H3/t16-,23?,25?/m1/s1 |
| InChIKey | PDDCPKPORGRAHB-UOMYTMTESA-N |
| XLogP | 5.40 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |