C26H22F9NO3S — CID 122678655
[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(3-fluorocyclobutyl)methanone (PubChem CID 122678655) has the molecular formula C26H22F9NO3S and a molecular weight of 599.52 g/mol. Its IUPAC name is [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(3-fluorocyclobutyl)methanone.
| Compound Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(3-fluorocyclobutyl)methanone |
|---|---|
| PubChem CID | 122678655 |
| Molecular Formula | C26H22F9NO3S |
| Molecular Weight | 599.52 g/mol |
| Exact Mass | 599.12 |
| IUPAC Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(3-fluorocyclobutyl)methanone |
| SMILES | O=C(C1CC(F)C1)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C26H22F9NO3S/c27-17-3-5-19(6-4-17)40(38,39)23-9-10-36(22(37)15-12-18(28)13-15)21(23)8-1-14-11-16(2-7-20(14)23)24(29,25(30,31)32)26(33,34)35/h2-7,11,15,18,21H,1,8-10,12-13H2/t15?,18?,21-,23-/m1/s1 |
| InChIKey | IHVZWPJUIUZODC-XGZPXUMOSA-N |
| XLogP | 6.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |