C26H25F8NO5S2 — CID 122678658
1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-propan-2-ylsulfonylethanone (PubChem CID 122678658) has the molecular formula C26H25F8NO5S2 and a molecular weight of 647.61 g/mol. Its IUPAC name is 1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-propan-2-ylsulfonylethanone.
| Compound Name | 1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-propan-2-ylsulfonylethanone |
|---|---|
| PubChem CID | 122678658 |
| Molecular Formula | C26H25F8NO5S2 |
| Molecular Weight | 647.61 g/mol |
| Exact Mass | 647.10 |
| IUPAC Name | 1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-propan-2-ylsulfonylethanone |
| SMILES | CC(C)S(=O)(=O)CC(=O)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C26H25F8NO5S2/c1-15(2)41(37,38)14-22(36)35-12-11-23(42(39,40)19-7-5-18(27)6-8-19)20-9-4-17(13-16(20)3-10-21(23)35)24(28,25(29,30)31)26(32,33)34/h4-9,13,15,21H,3,10-12,14H2,1-2H3/t21-,23-/m1/s1 |
| InChIKey | XBPPGWNYVTWTKT-FYYLOGMGSA-N |
| XLogP | 5.15 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |