C28H25F10NO3S — CID 122678659
[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4,4-difluorocyclohexyl)methanone (PubChem CID 122678659) has the molecular formula C28H25F10NO3S and a molecular weight of 645.56 g/mol. Its IUPAC name is [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4,4-difluorocyclohexyl)methanone.
| Compound Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4,4-difluorocyclohexyl)methanone |
|---|---|
| PubChem CID | 122678659 |
| Molecular Formula | C28H25F10NO3S |
| Molecular Weight | 645.56 g/mol |
| Exact Mass | 645.14 |
| IUPAC Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4,4-difluorocyclohexyl)methanone |
| SMILES | O=C(C1CCC(F)(F)CC1)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C28H25F10NO3S/c29-19-3-5-20(6-4-19)43(41,42)25-13-14-39(23(40)16-9-11-24(30,31)12-10-16)22(25)8-1-17-15-18(2-7-21(17)25)26(32,27(33,34)35)28(36,37)38/h2-7,15-16,22H,1,8-14H2/t22-,25-/m1/s1 |
| InChIKey | AOPFHWGNRUOVBK-RCZVLFRGSA-N |
| XLogP | 7.16 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.56 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |