C28H28F8N2O5S2 — CID 122678686
(3aR,9bR)-N-[(1,1-dioxothian-4-yl)methyl]-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide (PubChem CID 122678686) has the molecular formula C28H28F8N2O5S2 and a molecular weight of 688.66 g/mol. Its IUPAC name is (3aR,9bR)-N-[(1,1-dioxothian-4-yl)methyl]-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide.
| Compound Name | (3aR,9bR)-N-[(1,1-dioxothian-4-yl)methyl]-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide |
|---|---|
| PubChem CID | 122678686 |
| Molecular Formula | C28H28F8N2O5S2 |
| Molecular Weight | 688.66 g/mol |
| Exact Mass | 688.13 |
| IUPAC Name | (3aR,9bR)-N-[(1,1-dioxothian-4-yl)methyl]-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide |
| SMILES | O=C(NCC1CCS(=O)(=O)CC1)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C28H28F8N2O5S2/c29-20-3-5-21(6-4-20)45(42,43)25-11-12-38(24(39)37-16-17-9-13-44(40,41)14-10-17)23(25)8-1-18-15-19(2-7-22(18)25)26(30,27(31,32)33)28(34,35)36/h2-7,15,17,23H,1,8-14,16H2,(H,37,39)/t23-,25-/m1/s1 |
| InChIKey | OZSZNLKIRBSEAE-ILBGXUMGSA-N |
| XLogP | 5.34 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.66 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |