C27H23F8NO3S — CID 122678825
[9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,3a,4,5-tetrahydro-1H-benzo[e]isoindol-2-yl]-(cyclopenten-1-yl)methanone (PubChem CID 122678825) has the molecular formula C27H23F8NO3S and a molecular weight of 593.54 g/mol. Its IUPAC name is [9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,3a,4,5-tetrahydro-1H-benzo[e]isoindol-2-yl]-(cyclopenten-1-yl)methanone.
| Compound Name | [9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,3a,4,5-tetrahydro-1H-benzo[e]isoindol-2-yl]-(cyclopenten-1-yl)methanone |
|---|---|
| PubChem CID | 122678825 |
| Molecular Formula | C27H23F8NO3S |
| Molecular Weight | 593.54 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | [9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,3a,4,5-tetrahydro-1H-benzo[e]isoindol-2-yl]-(cyclopenten-1-yl)methanone |
| SMILES | O=C(C1=CCCC1)N1CC2CCc3cc(C(F)(C(F)(F)F)C(F)(F)F)ccc3C2(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C27H23F8NO3S/c28-20-8-10-21(11-9-20)40(38,39)24-15-36(23(37)16-3-1-2-4-16)14-19(24)6-5-17-13-18(7-12-22(17)24)25(29,26(30,31)32)27(33,34)35/h3,7-13,19H,1-2,4-6,14-15H2 |
| InChIKey | DZUXOKIFEXTESF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |