C28H27F8NO3S — CID 122678913
[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclohexylmethanone (PubChem CID 122678913) has the molecular formula C28H27F8NO3S and a molecular weight of 609.58 g/mol. Its IUPAC name is [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclohexylmethanone.
| Compound Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 122678913 |
| Molecular Formula | C28H27F8NO3S |
| Molecular Weight | 609.58 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclohexylmethanone |
| SMILES | O=C(C1CCCCC1)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C28H27F8NO3S/c29-20-8-10-21(11-9-20)41(39,40)25-14-15-37(24(38)17-4-2-1-3-5-17)23(25)13-6-18-16-19(7-12-22(18)25)26(30,27(31,32)33)28(34,35)36/h7-12,16-17,23H,1-6,13-15H2/t23-,25-/m1/s1 |
| InChIKey | JAQLPAODRGTVQT-ILBGXUMGSA-N |
| XLogP | 6.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.58 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |