C25H23F8NO3S — CID 122678948
1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-methylpropan-1-one (PubChem CID 122678948) has the molecular formula C25H23F8NO3S and a molecular weight of 569.51 g/mol. Its IUPAC name is 1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 122678948 |
| Molecular Formula | C25H23F8NO3S |
| Molecular Weight | 569.51 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | 1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C25H23F8NO3S/c1-14(2)21(35)34-12-11-22(38(36,37)18-7-5-17(26)6-8-18)19-9-4-16(13-15(19)3-10-20(22)34)23(27,24(28,29)30)25(31,32)33/h4-9,13-14,20H,3,10-12H2,1-2H3/t20-,22-/m1/s1 |
| InChIKey | PZEOTOMZRDNWHA-IFMALSPDSA-N |
| XLogP | 5.99 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |