C27H26F8N2O5S2 — CID 122679100
(3aR,9bR)-N-[(1,1-dioxothiolan-3-yl)methyl]-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide (PubChem CID 122679100) has the molecular formula C27H26F8N2O5S2 and a molecular weight of 674.63 g/mol. Its IUPAC name is (3aR,9bR)-N-[(1,1-dioxothiolan-3-yl)methyl]-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide.
| Compound Name | (3aR,9bR)-N-[(1,1-dioxothiolan-3-yl)methyl]-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide |
|---|---|
| PubChem CID | 122679100 |
| Molecular Formula | C27H26F8N2O5S2 |
| Molecular Weight | 674.63 g/mol |
| Exact Mass | 674.12 |
| IUPAC Name | (3aR,9bR)-N-[(1,1-dioxothiolan-3-yl)methyl]-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide |
| SMILES | O=C(NCC1CCS(=O)(=O)C1)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C27H26F8N2O5S2/c28-19-3-5-20(6-4-19)44(41,42)24-10-11-37(23(38)36-14-16-9-12-43(39,40)15-16)22(24)8-1-17-13-18(2-7-21(17)24)25(29,26(30,31)32)27(33,34)35/h2-7,13,16,22H,1,8-12,14-15H2,(H,36,38)/t16?,22-,24-/m1/s1 |
| InChIKey | FGXHDTAXBYJCLZ-QOPVDAPCSA-N |
| XLogP | 4.95 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |