C25H21F8NO3S — CID 122679152
[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclopropylmethanone (PubChem CID 122679152) has the molecular formula C25H21F8NO3S and a molecular weight of 567.50 g/mol. Its IUPAC name is [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclopropylmethanone.
| Compound Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 122679152 |
| Molecular Formula | C25H21F8NO3S |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C25H21F8NO3S/c26-17-5-7-18(8-6-17)38(36,37)22-11-12-34(21(35)14-1-2-14)20(22)10-3-15-13-16(4-9-19(15)22)23(27,24(28,29)30)25(31,32)33/h4-9,13-14,20H,1-3,10-12H2/t20-,22-/m1/s1 |
| InChIKey | DGVMLHUCFQGWJB-IFMALSPDSA-N |
| XLogP | 5.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |