About 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide
5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide (PubChem CID 122679232) has the molecular formula C8H8F2N4O2
and a molecular weight of 230.17 g/mol. Its IUPAC name is 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide |
| PubChem CID | 122679232 |
| Molecular Formula | C8H8F2N4O2 |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide |
| SMILES | NC(=O)c1nc[nH]c1C(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C8H8F2N4O2/c9-8(10)1-14(2-8)7(16)5-4(6(11)15)12-3-13-5/h3H,1-2H2,(H2,11,15)(H,12,13) |
| InChIKey | KXZOAMLSYBENIX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide?
The IUPAC name of 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide (CID 122679232) is 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide.
What is the SMILES notation for 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide?
The canonical SMILES for 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide is NC(=O)c1nc[nH]c1C(=O)N1CC(F)(F)C1.
What is the InChIKey of 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide?
The InChIKey is KXZOAMLSYBENIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2N4O2/c9-8(10)1-14(2-8)7(16)5-4(6(11)15)12-3-13-5/h3H,1-2H2,(H2,11,15)(H,12,13).
What are the key properties of 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide?
5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide has a molecular weight of 230.17 g/mol, XLogP of -0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-difluoroazetidine-1-carbonyl)-1H-imidazole-4-carboxamide is sourced from PubChem (CID 122679232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).