C20H19IN2O — CID 122679632
1-[(3S,3aS)-3-(4-iodophenyl)-8-methyl-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]ethanone (PubChem CID 122679632) has the molecular formula C20H19IN2O and a molecular weight of 426.29 g/mol. Its IUPAC name is 1-[(3S,3aS)-3-(4-iodophenyl)-8-methyl-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]ethanone.
| Compound Name | 1-[(3S,3aS)-3-(4-iodophenyl)-8-methyl-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]ethanone |
|---|---|
| PubChem CID | 122679632 |
| Molecular Formula | C20H19IN2O |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 1-[(3S,3aS)-3-(4-iodophenyl)-8-methyl-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]ethanone |
| SMILES | CC(=O)N1N=C2c3cc(C)ccc3CC[C@H]2[C@H]1c1ccc([123I])cc1 |
| InChI | InChI=1S/C20H19IN2O/c1-12-3-4-14-7-10-17-19(18(14)11-12)22-23(13(2)24)20(17)15-5-8-16(21)9-6-15/h3-6,8-9,11,17,20H,7,10H2,1-2H3/t17-,20-/m1/s1/i21-4 |
| InChIKey | HQVPJIIBDVMIGP-SAZYBDBJSA-N |
| XLogP | 4.47 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|