C23H14F4N2O9 — CID 122679768
2-[3-[1,1-difluoro-2-(5-formyloxy-1,3-dioxoisoindol-2-yl)ethoxy]-2,2-difluoropropyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 122679768) has the molecular formula C23H14F4N2O9 and a molecular weight of 538.36 g/mol. Its IUPAC name is 2-[3-[1,1-difluoro-2-(5-formyloxy-1,3-dioxoisoindol-2-yl)ethoxy]-2,2-difluoropropyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[3-[1,1-difluoro-2-(5-formyloxy-1,3-dioxoisoindol-2-yl)ethoxy]-2,2-difluoropropyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 122679768 |
| Molecular Formula | C23H14F4N2O9 |
| Molecular Weight | 538.36 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | 2-[3-[1,1-difluoro-2-(5-formyloxy-1,3-dioxoisoindol-2-yl)ethoxy]-2,2-difluoropropyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=COc1ccc2c(c1)C(=O)N(CC(F)(F)OCC(F)(F)CN1C(=O)c3ccc(C(=O)O)cc3C1=O)C2=O |
| InChI | InChI=1S/C23H14F4N2O9/c24-22(25,7-28-17(31)13-3-1-11(21(35)36)5-15(13)19(28)33)9-38-23(26,27)8-29-18(32)14-4-2-12(37-10-30)6-16(14)20(29)34/h1-6,10H,7-9H2,(H,35,36) |
| InChIKey | BYDUKDRLZQCHEF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|