About 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole
5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole (PubChem CID 122679816) has the molecular formula C17H30N2
and a molecular weight of 262.44 g/mol. Its IUPAC name is 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole.
Molecular Properties
| Compound Name | 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole |
| PubChem CID | 122679816 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole |
| SMILES | CC(C)n1cc2c(n1)CCC(C(C)C)(C(C)(C)C)C2 |
| InChI | InChI=1S/C17H30N2/c1-12(2)17(16(5,6)7)9-8-15-14(10-17)11-19(18-15)13(3)4/h11-13H,8-10H2,1-7H3 |
| InChIKey | XYQGDVRUBNNFRC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole?
The IUPAC name of 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole (CID 122679816) is 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole.
What is the SMILES notation for 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole?
The canonical SMILES for 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole is CC(C)n1cc2c(n1)CCC(C(C)C)(C(C)(C)C)C2.
What is the InChIKey of 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole?
The InChIKey is XYQGDVRUBNNFRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2/c1-12(2)17(16(5,6)7)9-8-15-14(10-17)11-19(18-15)13(3)4/h11-13H,8-10H2,1-7H3.
What are the key properties of 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole?
5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole has a molecular weight of 262.44 g/mol, XLogP of 4.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2,5-di(propan-2-yl)-6,7-dihydro-4H-indazole is sourced from PubChem (CID 122679816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).